Aromatic Hydrocarbons - 5


Chemistry Class 12
1.    Benzene is more stable than the 1,3,5 cyclohexatriene by




Chemistry Class 12
2.    When cyclohexane and its derivatives are dehydrogenated in the presence of catalyst they give




Chemistry Class 12
3.    Hydrolysis of benzene sulphonic acid with superheated steam or by boiling with dil.HCl gives




Chemistry Class 12
4.    The benzene ring in oxidized to maleic anhydride when strongly heated with




Chemistry Class 12
5. When nitrobenzene is treated with chlorine in the presence of FeCl3 the following product is obtained




Chemistry Class 12
6.    -COOH, CHO & -RCO, when attached with benzene ring as substitutent, behave as




Chemistry Class 12
7. C6H12 + Pt/250Co




Chemistry Class 12
8. CH3(CH2)5CH3+Cr2O3+Al2O3+SiO2/500oC




This is more feedback!
This is the feedback!